| Name |
3-cyclopropyl-2-[({3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)sulfanyl]-3H,4H-thieno[3,2-d]pyrimidin-4-one
|
| Molecular Formula |
C19H13F3N4O2S2
|
| Molecular Weight |
450.5
|
| Smiles |
O=c1c2sccc2nc(SCc2nc(-c3cccc(C(F)(F)F)c3)no2)n1C1CC1
|
O=c1c2sccc2nc(SCc2nc(-c3cccc(C(F)(F)F)c3)no2)n1C1CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.