| Name |
2-Butene, 1,1,1,4,4,4-hexafluoro-2,3-dimethoxy-, (E)-
|
| Molecular Formula |
C6H6F6O2
|
| Molecular Weight |
224.10
|
| Smiles |
COC(=C(OC)C(F)(F)F)C(F)(F)F
|
COC(=C(OC)C(F)(F)F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.