| Name |
N-(butan-2-yl)-2-(3,4-dimethoxyphenyl)-3,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine
|
| Molecular Formula |
C20H26N4O2
|
| Molecular Weight |
354.4
|
| Smiles |
CCC(C)Nc1cc(C)nc2c(C)c(-c3ccc(OC)c(OC)c3)nn12
|
CCC(C)Nc1cc(C)nc2c(C)c(-c3ccc(OC)c(OC)c3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.