| Name |
1-(2-Chlorobenzenesulfonyl)-4-{3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl}piperazine
|
| Molecular Formula |
C18H19ClN6O2S
|
| Molecular Weight |
418.9
|
| Smiles |
O=S(=O)(c1ccccc1Cl)N1CCN(c2ccc3nnc(C4CC4)n3n2)CC1
|
O=S(=O)(c1ccccc1Cl)N1CCN(c2ccc3nnc(C4CC4)n3n2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.