| Name |
Ethyl 2-ethoxy-3-[4-(2-{4-methylsulfonyloxyphenyl}ethoxy)phenyl]propanoate
|
| Molecular Formula |
C22H28O7S
|
| Molecular Weight |
436.5
|
| Smiles |
CCOC(=O)C(Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1)OCC
|
CCOC(=O)C(Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1)OCC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.