| Name |
2-{[3-(3-Bromophenyl)-1,2,4-oxadiazol-5-yl]methyl}-6-(3-methoxyphenyl)-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C20H15BrN4O3
|
| Molecular Weight |
439.3
|
| Smiles |
COc1cccc(-c2ccc(=O)n(Cc3nc(-c4cccc(Br)c4)no3)n2)c1
|
COc1cccc(-c2ccc(=O)n(Cc3nc(-c4cccc(Br)c4)no3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.