| Name |
1-{2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-2-methyl-1H-benzimidazole
|
| Molecular Formula |
C18H15ClN4O
|
| Molecular Weight |
338.8
|
| Smiles |
Cc1nc2ccccc2n1CCc1noc(-c2ccc(Cl)cc2)n1
|
Cc1nc2ccccc2n1CCc1noc(-c2ccc(Cl)cc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.