| Name |
2-(4-chlorophenyl)-N-{[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methyl}acetamide
|
| Molecular Formula |
C18H13ClF2N2O2
|
| Molecular Weight |
362.8
|
| Smiles |
O=C(Cc1ccc(Cl)cc1)NCc1cc(-c2ccc(F)cc2F)on1
|
O=C(Cc1ccc(Cl)cc1)NCc1cc(-c2ccc(F)cc2F)on1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.