| Name |
4-chloro-N-[4-({[(4-chlorophenyl)methyl]carbamoyl}methyl)-1,3-thiazol-2-yl]benzamide
|
| Molecular Formula |
C19H15Cl2N3O2S
|
| Molecular Weight |
420.3
|
| Smiles |
O=C(Cc1csc(NC(=O)c2ccc(Cl)cc2)n1)NCc1ccc(Cl)cc1
|
O=C(Cc1csc(NC(=O)c2ccc(Cl)cc2)n1)NCc1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.