| Name |
Acetamide, N-[4-(2-phenyldiazenyl)phenyl]-2-[[5-(phenylmethyl)-1,3,4-oxadiazol-2-yl]thio]-
|
| Molecular Formula |
C23H19N5O2S
|
| Molecular Weight |
429.5
|
| Smiles |
O=C(CSc1nnc(Cc2ccccc2)o1)Nc1ccc(N=Nc2ccccc2)cc1
|
O=C(CSc1nnc(Cc2ccccc2)o1)Nc1ccc(N=Nc2ccccc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.