| Name |
methyl 4-({3-ethyl-7-oxo-3H,6H,7H-[1,2,3]triazolo[4,5-d]pyrimidin-6-yl}methyl)benzoate
|
| Molecular Formula |
C15H15N5O3
|
| Molecular Weight |
313.31
|
| Smiles |
CCn1nnc2c(=O)n(Cc3ccc(C(=O)OC)cc3)cnc21
|
CCn1nnc2c(=O)n(Cc3ccc(C(=O)OC)cc3)cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.