| Name |
7-Bromo-5-bromomethyl-2,3-dimethoxyquinoxaline
|
| Molecular Formula |
C11H10Br2N2O2
|
| Molecular Weight |
362.02
|
| Smiles |
COc1nc2cc(Br)cc(CBr)c2nc1OC
|
COc1nc2cc(Br)cc(CBr)c2nc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.