| Name |
10-(Trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[5,1-a]isoquinoline
|
| Molecular Formula |
C11H8F3N3
|
| Molecular Weight |
239.20
|
| Smiles |
FC(F)(F)c1cccc2c1-c1ncnn1CC2
|
FC(F)(F)c1cccc2c1-c1ncnn1CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.