| Name |
L-Alanine, glycyl-L-asparaginyl-L-phenylalanyl-L-leucyl-L-glutaminyl-L-seryl-L-arginyl-L-prolyl-L-alpha-glutamyl-L-prolyl-L-threonyl-L-alanyl-L-prolyl-L-prolyl-
|
| Molecular Formula |
C70H108N20O22
|
| Molecular Weight |
1581.7
|
| Smiles |
CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(CC(N)=O)NC(=O)CN)C(=O)NC(CCC(N)=O)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(C(=O)NC(C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NC(C)C(=O)O)C(C)O
|
CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(CC(N)=O)NC(=O)CN)C(=O)NC(CCC(N)=O)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(C(=O)NC(C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NC(C)C(=O)O)C(C)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.