| Name |
Sodium 1-(2-ethoxy-2-oxoethyl)-8-ethyl-3,4-dihydro-1h-pyrano[3,4-b]indol-9-ide
|
| Molecular Formula |
C17H20NNaO3
|
| Molecular Weight |
309.33
|
| Smiles |
CCOC(=O)CC1OCCc2c1[n-]c1c(CC)cccc21.[Na+]
|
CCOC(=O)CC1OCCc2c1[n-]c1c(CC)cccc21.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.