| Name |
Ethyl 2-(3-cyclopropyl-6-ethyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-1-yl)acetate
|
| Molecular Formula |
C16H18F3N3O2
|
| Molecular Weight |
341.33
|
| Smiles |
CCOC(=O)Cn1nc(C2CC2)c2c(C(F)(F)F)cc(CC)nc21
|
CCOC(=O)Cn1nc(C2CC2)c2c(C(F)(F)F)cc(CC)nc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.