| Name |
1-(3-Bromophenyl)-1H-1,2,3-triazole-5-carboxylic acid
|
| Molecular Formula |
C9H6BrN3O2
|
| Molecular Weight |
268.07
|
| Smiles |
O=C(O)c1cnnn1-c1cccc(Br)c1
|
O=C(O)c1cnnn1-c1cccc(Br)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.