| Name |
N-(3,4-dimethoxyphenyl)-2-({3-ethyl-4-oxo-3H,4H,6H,7H-thieno[3,2-d]pyrimidin-2-yl}sulfanyl)acetamide
|
| Molecular Formula |
C18H21N3O4S2
|
| Molecular Weight |
407.5
|
| Smiles |
CCn1c(SCC(=O)Nc2ccc(OC)c(OC)c2)nc2c(c1=O)SCC2
|
CCn1c(SCC(=O)Nc2ccc(OC)c(OC)c2)nc2c(c1=O)SCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.