| Name |
N-(4-ethoxyphenyl)-2-{[3-(4-methylbenzyl)-4-oxo-3,4-dihydro[1]benzofuro[3,2-d]pyrimidin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C28H25N3O4S
|
| Molecular Weight |
499.6
|
| Smiles |
CCOc1ccc(NC(=O)CSc2nc3c(oc4ccccc43)c(=O)n2Cc2ccc(C)cc2)cc1
|
CCOc1ccc(NC(=O)CSc2nc3c(oc4ccccc43)c(=O)n2Cc2ccc(C)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.