| Name |
tert-butyl 2-(5-sulfanyl-1H-1,2,3,4-tetrazol-1-yl)acetate
|
| Molecular Formula |
C7H12N4O2S
|
| Molecular Weight |
216.26
|
| Smiles |
CC(C)(C)OC(=O)Cn1[nH]nnc1=S
|
CC(C)(C)OC(=O)Cn1[nH]nnc1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.