| Name |
Ethyl 3-(4-ethyl-3,5-dioxo-2-phenyl-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)-1,2,4-oxadiazole-5-carboxylate
|
| Molecular Formula |
C16H15N5O5
|
| Molecular Weight |
357.32
|
| Smiles |
CCOC(=O)c1nc(-c2nn(-c3ccccc3)c(=O)n(CC)c2=O)no1
|
CCOC(=O)c1nc(-c2nn(-c3ccccc3)c(=O)n(CC)c2=O)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.