| Name |
2,2,2-Trifluoro-1-(1,2,4,5-tetrahydro-6,8-dinitro-1,5-methano-3H-3-benzazepin-3-yl) ethanone
|
| Molecular Formula |
C13H10F3N3O5
|
| Molecular Weight |
345.23
|
| Smiles |
O=C(N1CC2CC(C1)c1c2cc([N+](=O)[O-])cc1[N+](=O)[O-])C(F)(F)F
|
O=C(N1CC2CC(C1)c1c2cc([N+](=O)[O-])cc1[N+](=O)[O-])C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.