Chemical Name: N-(3-chloro-4-fluorophenyl)-2-{10-thia-3,4,6,8-tetraazatetracyclo[7.7.0.0^{2,6}.0^{11,16}]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl}acetamide
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.
Chemsrc provides CAS#:950273-50-4 MSDS, density, melting point, boiling point, structure, formula, molecular weight, synthetic route, etc. title: CAS No. 950273-50-4 | Chemsrc address: https://m.chemsrc.com/en/baike/2613655.html