| Name |
3'-(4-Fluorophenyl)-1-[(3-fluorophenyl)methyl]-1,2-dihydrospiro[indole-3,2'-[1lambda6,3]thiazolidine]-1',1',2,4'-tetrone
|
| Molecular Formula |
C23H16F2N2O4S
|
| Molecular Weight |
454.4
|
| Smiles |
O=C1CS(=O)(=O)C2(C(=O)N(Cc3cccc(F)c3)c3ccccc32)N1c1ccc(F)cc1
|
O=C1CS(=O)(=O)C2(C(=O)N(Cc3cccc(F)c3)c3ccccc32)N1c1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.