| Name |
2-({8,9-Dimethoxy-2-phenyl-[1,2,4]triazolo[1,5-C]quinazolin-5-YL}sulfanyl)-N-(4-ethoxyphenyl)acetamide
|
| Molecular Formula |
C27H25N5O4S
|
| Molecular Weight |
515.6
|
| Smiles |
CCOc1ccc(NC(=O)CSc2nc3cc(OC)c(OC)cc3c3nc(-c4ccccc4)nn23)cc1
|
CCOc1ccc(NC(=O)CSc2nc3cc(OC)c(OC)cc3c3nc(-c4ccccc4)nn23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.