| Name |
4,4a(2)-[1,3-Phenylenebis(1,3,4-oxadiazole-5,2-diyl)]bis[N,N-dimethylbenzenamine]
|
| Molecular Formula |
C26H24N6O2
|
| Molecular Weight |
452.5
|
| Smiles |
CN(C)c1ccc(-c2nnc(-c3cccc(-c4nnc(-c5ccc(N(C)C)cc5)o4)c3)o2)cc1
|
CN(C)c1ccc(-c2nnc(-c3cccc(-c4nnc(-c5ccc(N(C)C)cc5)o4)c3)o2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.