| Name |
ethyl 4-(2-{5-benzyl-8-fluoro-3-oxo-2H,3H,5H-pyrazolo[4,3-c]quinolin-2-yl}acetamido)benzoate
|
| Molecular Formula |
C28H23FN4O4
|
| Molecular Weight |
498.5
|
| Smiles |
CCOC(=O)c1ccc(NC(=O)Cn2nc3c4cc(F)ccc4n(Cc4ccccc4)cc-3c2=O)cc1
|
CCOC(=O)c1ccc(NC(=O)Cn2nc3c4cc(F)ccc4n(Cc4ccccc4)cc-3c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.