| Name |
5-(2,6-Dichlorophenyl)-1,3,4-oxadiazol-2-amine
|
| Molecular Formula |
C8H5Cl2N3O
|
| Molecular Weight |
230.05
|
| Smiles |
Nc1nnc(-c2c(Cl)cccc2Cl)o1
|
Nc1nnc(-c2c(Cl)cccc2Cl)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.