| Name |
(3s,4r,5r)-N-Cyclopropyl-N'-[(2r)-1-Ethoxy-4-Methylpentan-2-Yl]-4-Hydroxy-N-[5-(Propan-2-Yl)pyridin-2-Yl]piperidine-3,5-Dicarboxamide
|
| Molecular Formula |
C26H42N4O4
|
| Molecular Weight |
474.6
|
| Smiles |
CCOCC(CC(C)C)NC(=O)C1CNCC(C(=O)N(c2ccc(C(C)C)cn2)C2CC2)C1O
|
CCOCC(CC(C)C)NC(=O)C1CNCC(C(=O)N(c2ccc(C(C)C)cn2)C2CC2)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.