| Name |
O1-tert-butyl O2-ethyl (2R,3R)-3-azidopyrrolidine-1,2-dicarboxylate
|
| Molecular Formula |
C12H20N4O4
|
| Molecular Weight |
284.31
|
| Smiles |
CCOC(=O)C1C(N=[N+]=[N-])CCN1C(=O)OC(C)(C)C
|
CCOC(=O)C1C(N=[N+]=[N-])CCN1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.