| Name |
3-isopropyl-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one
|
| Molecular Formula |
C9H11N3O
|
| Molecular Weight |
177.20
|
| Smiles |
CC(C)n1c(=O)[nH]c2cccnc21
|
CC(C)n1c(=O)[nH]c2cccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.