| Name |
N-(2,5-Dimethoxyphenyl)-2-{[3-(4-methylphenyl)-1,4-diazaspiro[4.4]nona-1,3-dien-2-YL]sulfanyl}acetamide
|
| Molecular Formula |
C24H27N3O3S
|
| Molecular Weight |
437.6
|
| Smiles |
COc1ccc(OC)c(NC(=O)CSC2=NC3(CCCC3)N=C2c2ccc(C)cc2)c1
|
COc1ccc(OC)c(NC(=O)CSC2=NC3(CCCC3)N=C2c2ccc(C)cc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.