| Name |
(7-{[(2-Fluorophenyl)methyl]sulfanyl}-14-methyl-5-(3-methylphenyl)-2-oxa-4,6,13-triazatricyclo[8.4.0.0^{3,8}]tetradeca-1(10),3(8),4,6,11,13-hexaen-11-yl)methanol
|
| Molecular Formula |
C26H22FN3O2S
|
| Molecular Weight |
459.5
|
| Smiles |
Cc1cccc(-c2nc3c(c(SCc4ccccc4F)n2)Cc2c(CO)cnc(C)c2O3)c1
|
Cc1cccc(-c2nc3c(c(SCc4ccccc4F)n2)Cc2c(CO)cnc(C)c2O3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.