| Name |
5-chloro-N-{5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl}-2-(methylsulfanyl)pyrimidine-4-carboxamide
|
| Molecular Formula |
C16H12ClFN4OS2
|
| Molecular Weight |
394.9
|
| Smiles |
CSc1ncc(Cl)c(C(=O)Nc2ncc(Cc3ccc(F)cc3)s2)n1
|
CSc1ncc(Cl)c(C(=O)Nc2ncc(Cc3ccc(F)cc3)s2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.