| Name |
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N-bis(furan-2-ylmethyl)-1,2-oxazole-3-carboxamide
|
| Molecular Formula |
C22H18N2O6
|
| Molecular Weight |
406.4
|
| Smiles |
O=C(c1cc(-c2ccc3c(c2)OCCO3)on1)N(Cc1ccco1)Cc1ccco1
|
O=C(c1cc(-c2ccc3c(c2)OCCO3)on1)N(Cc1ccco1)Cc1ccco1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.