| Name |
2-(5-Amino-2-oxo-1,2-dihydropyridin-1-YL)-N-(propan-2-YL)acetamide
|
| Molecular Formula |
C10H15N3O2
|
| Molecular Weight |
209.24
|
| Smiles |
CC(C)NC(=O)Cn1cc(N)ccc1=O
|
CC(C)NC(=O)Cn1cc(N)ccc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.