| Name |
N-cyclohexyl-2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}acetamide
|
| Molecular Formula |
C22H24N4OS2
|
| Molecular Weight |
424.6
|
| Smiles |
Cc1nc(-c2ccccc2)sc1-c1ccc(SCC(=O)NC2CCCCC2)nn1
|
Cc1nc(-c2ccccc2)sc1-c1ccc(SCC(=O)NC2CCCCC2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.