| Name |
7-(3,4-difluorophenyl)-2-ethyl-3-(4-methoxyphenyl)pyrazolo[1,5-a]pyrido[3,4-e]pyrimidin-6(7H)-one
|
| Molecular Formula |
C24H18F2N4O2
|
| Molecular Weight |
432.4
|
| Smiles |
CCc1nn2c(ncc3c(=O)n(-c4ccc(F)c(F)c4)ccc32)c1-c1ccc(OC)cc1
|
CCc1nn2c(ncc3c(=O)n(-c4ccc(F)c(F)c4)ccc32)c1-c1ccc(OC)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.