| Name |
tert-butyl 3-{3H-imidazo[4,5-b]pyridin-2-yl}piperidine-1-carboxylate
|
| Molecular Formula |
C16H22N4O2
|
| Molecular Weight |
302.37
|
| Smiles |
CC(C)(C)OC(=O)N1CCCC(c2nc3ncccc3[nH]2)C1
|
CC(C)(C)OC(=O)N1CCCC(c2nc3ncccc3[nH]2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.