| Name |
3,5-Bis(4-methylphenyl)-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.0^{2,6}.0^{11,15}]hexadeca-1(16),2(6),4,7,9,11(15)-hexaene
|
| Molecular Formula |
C25H19N3O2
|
| Molecular Weight |
393.4
|
| Smiles |
Cc1ccc(-c2nn(-c3ccc(C)cc3)c3c2cnc2cc4c(cc23)OCO4)cc1
|
Cc1ccc(-c2nn(-c3ccc(C)cc3)c3c2cnc2cc4c(cc23)OCO4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.