| Name |
2H-1-Benzopyran-2-one, 6-fluoro-3-nitro-
|
| Molecular Formula |
C9H4FNO4
|
| Molecular Weight |
209.13
|
| Smiles |
O=c1oc2ccc(F)cc2cc1[N+](=O)[O-]
|
O=c1oc2ccc(F)cc2cc1[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.