| Name |
N-[2-(4-chlorophenyl)ethyl]-3-[(5,5-dioxido-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide
|
| Molecular Formula |
C20H20ClN3O3S2
|
| Molecular Weight |
450.0
|
| Smiles |
O=C(NCCc1ccc(Cl)cc1)c1cccc(NC2=NC3CS(=O)(=O)CC3S2)c1
|
O=C(NCCc1ccc(Cl)cc1)c1cccc(NC2=NC3CS(=O)(=O)CC3S2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.