| Name |
2-{[3-(3,4-Dichlorophenyl)-8-methyl-1,4-diazaspiro[4.5]deca-1,3-dien-2-YL]sulfanyl}-N-(4-methoxyphenyl)acetamide
|
| Molecular Formula |
C24H25Cl2N3O2S
|
| Molecular Weight |
490.4
|
| Smiles |
COc1ccc(NC(=O)CSC2=NC3(CCC(C)CC3)N=C2c2ccc(Cl)c(Cl)c2)cc1
|
COc1ccc(NC(=O)CSC2=NC3(CCC(C)CC3)N=C2c2ccc(Cl)c(Cl)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.