| Name |
2-{[5-(4-chlorophenyl)-11-(hydroxymethyl)-14-methyl-2-oxa-4,6,13-triazatricyclo[8.4.0.0^{3,8}]tetradeca-1(10),3(8),4,6,11,13-hexaen-7-yl]sulfanyl}-N-(4-fluorophenyl)acetamide
|
| Molecular Formula |
C26H20ClFN4O3S
|
| Molecular Weight |
523.0
|
| Smiles |
Cc1ncc(CO)c2c1Oc1nc(-c3ccc(Cl)cc3)nc(SCC(=O)Nc3ccc(F)cc3)c1C2
|
Cc1ncc(CO)c2c1Oc1nc(-c3ccc(Cl)cc3)nc(SCC(=O)Nc3ccc(F)cc3)c1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.