| Name |
[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl 1-(4-ethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C25H26N4O4
|
| Molecular Weight |
446.5
|
| Smiles |
CCOc1ccc(-c2nc(COC(=O)c3nnn(-c4ccc(CC)cc4)c3C)c(C)o2)cc1
|
CCOc1ccc(-c2nc(COC(=O)c3nnn(-c4ccc(CC)cc4)c3C)c(C)o2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.