| Name |
2,3-Bis[(N-2,4,6-trimethylphenyl)imino]butane-nickel(II)-dibromide
|
| Molecular Formula |
C22H28Br2N2Ni
|
| Molecular Weight |
539.0
|
| Smiles |
Br[Ni]Br.CC(=Nc1c(C)cc(C)cc1C)C(C)=Nc1c(C)cc(C)cc1C
|
Br[Ni]Br.CC(=Nc1c(C)cc(C)cc1C)C(C)=Nc1c(C)cc(C)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.