| Name |
7-{[(6-Chloro-1,3-benzodioxol-5-yl)methyl]sulfanyl}-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine
|
| Molecular Formula |
C14H11ClN4O2S
|
| Molecular Weight |
334.8
|
| Smiles |
Cc1cc(SCc2cc3c(cc2Cl)OCO3)n2ncnc2n1
|
Cc1cc(SCc2cc3c(cc2Cl)OCO3)n2ncnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.