| Name |
2-fluoro-N-{[6-(4-fluorophenyl)-2H,3H-imidazo[2,1-b][1,3]thiazol-5-yl]methyl}benzamide
|
| Molecular Formula |
C19H15F2N3OS
|
| Molecular Weight |
371.4
|
| Smiles |
O=C(NCc1c(-c2ccc(F)cc2)nc2n1CCS2)c1ccccc1F
|
O=C(NCc1c(-c2ccc(F)cc2)nc2n1CCS2)c1ccccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.