| Name |
3-(2-chlorophenyl)-N-{[4-(2-methoxyphenyl)oxan-4-yl]methyl}-5-methyl-1,2-oxazole-4-carboxamide
|
| Molecular Formula |
C24H25ClN2O4
|
| Molecular Weight |
440.9
|
| Smiles |
COc1ccccc1C1(CNC(=O)c2c(-c3ccccc3Cl)noc2C)CCOCC1
|
COc1ccccc1C1(CNC(=O)c2c(-c3ccccc3Cl)noc2C)CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.