| Name |
methyl 3-{[2-(3,4-dimethylphenyl)-1,1,3-trioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazin-4-yl]methyl}-4-methoxybenzoate
|
| Molecular Formula |
C25H24N2O6S
|
| Molecular Weight |
480.5
|
| Smiles |
COC(=O)c1ccc(OC)c(CN2C(=O)N(c3ccc(C)c(C)c3)S(=O)(=O)c3ccccc32)c1
|
COC(=O)c1ccc(OC)c(CN2C(=O)N(c3ccc(C)c(C)c3)S(=O)(=O)c3ccccc32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.